C21H24FNO5S — CID 7878247
[2-(4-fluorophenyl)-2-oxoethyl] (2S)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoate (PubChem CID 7878247) has the molecular formula C21H24FNO5S and a molecular weight of 421.49 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] (2S)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] (2S)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoate |
|---|---|
| PubChem CID | 7878247 |
| Molecular Formula | C21H24FNO5S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] (2S)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CC(C)C)C(=O)OCC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H24FNO5S/c1-14(2)12-19(23-29(26,27)18-10-4-15(3)5-11-18)21(25)28-13-20(24)16-6-8-17(22)9-7-16/h4-11,14,19,23H,12-13H2,1-3H3/t19-/m0/s1 |
| InChIKey | CIHBTUMYLFAYRS-IBGZPJMESA-N |
| XLogP | 3.25 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |