C21H24BrNO5S — CID 2925146
[2-(4-bromophenyl)-2-oxoethyl] 3-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoate (PubChem CID 2925146) has the molecular formula C21H24BrNO5S and a molecular weight of 482.40 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 3-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 3-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoate |
|---|---|
| PubChem CID | 2925146 |
| Molecular Formula | C21H24BrNO5S |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 3-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoate |
| SMILES | CCC(C)C(NS(=O)(=O)c1ccc(C)cc1)C(=O)OCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H24BrNO5S/c1-4-15(3)20(23-29(26,27)18-11-5-14(2)6-12-18)21(25)28-13-19(24)16-7-9-17(22)10-8-16/h5-12,15,20,23H,4,13H2,1-3H3 |
| InChIKey | GXSSOZLFLKQNMP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |