C12H16BrNO4S — CID 6362488
(2S,3R)-2-[(4-bromophenyl)sulfonylamino]-3-methylpentanoic acid (PubChem CID 6362488) has the molecular formula C12H16BrNO4S and a molecular weight of 350.23 g/mol. Its IUPAC name is (2S,3R)-2-[(4-bromophenyl)sulfonylamino]-3-methylpentanoic acid.
| Compound Name | (2S,3R)-2-[(4-bromophenyl)sulfonylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 6362488 |
| Molecular Formula | C12H16BrNO4S |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | (2S,3R)-2-[(4-bromophenyl)sulfonylamino]-3-methylpentanoic acid |
| SMILES | CC[C@@H](C)[C@H](NS(=O)(=O)c1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C12H16BrNO4S/c1-3-8(2)11(12(15)16)14-19(17,18)10-6-4-9(13)5-7-10/h4-8,11,14H,3H2,1-2H3,(H,15,16)/t8-,11+/m1/s1 |
| InChIKey | HPTIFMDZYFQKHI-KCJUWKMLSA-N |
| XLogP | 2.23 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |