C12H15FNO4S- — CID 6935683
(2R,3R)-2-[(4-fluorophenyl)sulfonylamino]-3-methylpentanoate (PubChem CID 6935683) has the molecular formula C12H15FNO4S- and a molecular weight of 288.32 g/mol. Its IUPAC name is (2R,3R)-2-[(4-fluorophenyl)sulfonylamino]-3-methylpentanoate.
| Compound Name | (2R,3R)-2-[(4-fluorophenyl)sulfonylamino]-3-methylpentanoate |
|---|---|
| PubChem CID | 6935683 |
| Molecular Formula | C12H15FNO4S- |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | (2R,3R)-2-[(4-fluorophenyl)sulfonylamino]-3-methylpentanoate |
| SMILES | CC[C@@H](C)[C@@H](NS(=O)(=O)c1ccc(F)cc1)C(=O)[O-] |
| InChI | InChI=1S/C12H16FNO4S/c1-3-8(2)11(12(15)16)14-19(17,18)10-6-4-9(13)5-7-10/h4-8,11,14H,3H2,1-2H3,(H,15,16)/p-1/t8-,11-/m1/s1 |
| InChIKey | UXOPGXZTLNPMIR-LDYMZIIASA-M |
| XLogP | 0.27 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |