C14H19N2O5S- — CID 7448572
(2R,3R)-2-[(4-acetamidophenyl)sulfonylamino]-3-methylpentanoate (PubChem CID 7448572) has the molecular formula C14H19N2O5S- and a molecular weight of 327.38 g/mol. Its IUPAC name is (2R,3R)-2-[(4-acetamidophenyl)sulfonylamino]-3-methylpentanoate.
| Compound Name | (2R,3R)-2-[(4-acetamidophenyl)sulfonylamino]-3-methylpentanoate |
|---|---|
| PubChem CID | 7448572 |
| Molecular Formula | C14H19N2O5S- |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | (2R,3R)-2-[(4-acetamidophenyl)sulfonylamino]-3-methylpentanoate |
| SMILES | CC[C@@H](C)[C@@H](NS(=O)(=O)c1ccc(NC(C)=O)cc1)C(=O)[O-] |
| InChI | InChI=1S/C14H20N2O5S/c1-4-9(2)13(14(18)19)16-22(20,21)12-7-5-11(6-8-12)15-10(3)17/h5-9,13,16H,4H2,1-3H3,(H,15,17)(H,18,19)/p-1/t9-,13-/m1/s1 |
| InChIKey | TZRUSBRYPGPVPQ-NOZJJQNGSA-M |
| XLogP | 0.09 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |