C12H15N2O6S- — CID 2325636
(2R,3R)-2-[(4-acetamidophenyl)sulfonylamino]-3-hydroxybutanoate (PubChem CID 2325636) has the molecular formula C12H15N2O6S- and a molecular weight of 315.33 g/mol. Its IUPAC name is (2R,3R)-2-[(4-acetamidophenyl)sulfonylamino]-3-hydroxybutanoate.
| Compound Name | (2R,3R)-2-[(4-acetamidophenyl)sulfonylamino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 2325636 |
| Molecular Formula | C12H15N2O6S- |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | (2R,3R)-2-[(4-acetamidophenyl)sulfonylamino]-3-hydroxybutanoate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N[C@@H](C(=O)[O-])[C@@H](C)O)cc1 |
| InChI | InChI=1S/C12H16N2O6S/c1-7(15)11(12(17)18)14-21(19,20)10-5-3-9(4-6-10)13-8(2)16/h3-7,11,14-15H,1-2H3,(H,13,16)(H,17,18)/p-1/t7-,11-/m1/s1 |
| InChIKey | ZHGRWRHFXFHHCV-RDDDGLTNSA-M |
| XLogP | -1.58 |
| TPSA | 135.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |