C13H17N2O5S- — CID 7314858
(2R)-2-[(4-acetamidophenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 7314858) has the molecular formula C13H17N2O5S- and a molecular weight of 313.36 g/mol. Its IUPAC name is (2R)-2-[(4-acetamidophenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | (2R)-2-[(4-acetamidophenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 7314858 |
| Molecular Formula | C13H17N2O5S- |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (2R)-2-[(4-acetamidophenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N[C@@H](C(=O)[O-])C(C)C)cc1 |
| InChI | InChI=1S/C13H18N2O5S/c1-8(2)12(13(17)18)15-21(19,20)11-6-4-10(5-7-11)14-9(3)16/h4-8,12,15H,1-3H3,(H,14,16)(H,17,18)/p-1/t12-/m1/s1 |
| InChIKey | DSOOEHVNCNKAPL-GFCCVEGCSA-M |
| XLogP | -0.30 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |