C14H15NO6S-2 — CID 6936085
(2R)-2-[[4-[(E)-2-carboxylatoethenyl]phenyl]sulfonylamino]-3-methylbutanoate (PubChem CID 6936085) has the molecular formula C14H15NO6S-2 and a molecular weight of 325.34 g/mol. Its IUPAC name is (2R)-2-[[4-[(E)-2-carboxylatoethenyl]phenyl]sulfonylamino]-3-methylbutanoate.
| Compound Name | (2R)-2-[[4-[(E)-2-carboxylatoethenyl]phenyl]sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 6936085 |
| Molecular Formula | C14H15NO6S-2 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | (2R)-2-[[4-[(E)-2-carboxylatoethenyl]phenyl]sulfonylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@@H](NS(=O)(=O)c1ccc(/C=C/C(=O)[O-])cc1)C(=O)[O-] |
| InChI | InChI=1S/C14H17NO6S/c1-9(2)13(14(18)19)15-22(20,21)11-6-3-10(4-7-11)5-8-12(16)17/h3-9,13,15H,1-2H3,(H,16,17)(H,18,19)/p-2/b8-5+/t13-/m1/s1 |
| InChIKey | QLQQYAUXJOGXED-OQHXTRMZSA-L |
| XLogP | -1.50 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|