About 2-hydroxypropanoate;(E)-3-phenylprop-2-enoate
2-hydroxypropanoate;(E)-3-phenylprop-2-enoate (PubChem CID 21183403) has the molecular formula C12H12O5-2
and a molecular weight of 236.22 g/mol. Its IUPAC name is 2-hydroxypropanoate;(E)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | 2-hydroxypropanoate;(E)-3-phenylprop-2-enoate |
| PubChem CID | 21183403 |
| Molecular Formula | C12H12O5-2 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-hydroxypropanoate;(E)-3-phenylprop-2-enoate |
| SMILES | CC(O)C(=O)[O-].O=C([O-])/C=C/c1ccccc1 |
| InChI | InChI=1S/C9H8O2.C3H6O3/c10-9(11)7-6-8-4-2-1-3-5-8;1-2(4)3(5)6/h1-7H,(H,10,11);2,4H,1H3,(H,5,6)/p-2/b7-6+; |
| InChIKey | UFUWBQHZFOEMSC-UHDJGPCESA-L |
| XLogP | -1.43 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropanoate;(E)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropanoate;(E)-3-phenylprop-2-enoate?
The IUPAC name of 2-hydroxypropanoate;(E)-3-phenylprop-2-enoate (CID 21183403) is 2-hydroxypropanoate;(E)-3-phenylprop-2-enoate.
What is the SMILES notation for 2-hydroxypropanoate;(E)-3-phenylprop-2-enoate?
The canonical SMILES for 2-hydroxypropanoate;(E)-3-phenylprop-2-enoate is CC(O)C(=O)[O-].O=C([O-])/C=C/c1ccccc1.
What is the InChIKey of 2-hydroxypropanoate;(E)-3-phenylprop-2-enoate?
The InChIKey is UFUWBQHZFOEMSC-UHDJGPCESA-L. The full InChI is InChI=1S/C9H8O2.C3H6O3/c10-9(11)7-6-8-4-2-1-3-5-8;1-2(4)3(5)6/h1-7H,(H,10,11);2,4H,1H3,(H,5,6)/p-2/b7-6+;.
What are the key properties of 2-hydroxypropanoate;(E)-3-phenylprop-2-enoate?
2-hydroxypropanoate;(E)-3-phenylprop-2-enoate has a molecular weight of 236.22 g/mol, XLogP of -1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropanoate;(E)-3-phenylprop-2-enoate is sourced from PubChem (CID 21183403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).