About 2-hydroxypropanoate;phenylmercury(1+)
2-hydroxypropanoate;phenylmercury(1+) (PubChem CID 67544272) has the molecular formula C9H10HgO3
and a molecular weight of 366.77 g/mol. Its IUPAC name is 2-hydroxypropanoate;phenylmercury(1+).
Molecular Properties
| Compound Name | 2-hydroxypropanoate;phenylmercury(1+) |
| PubChem CID | 67544272 |
| Molecular Formula | C9H10HgO3 |
| Molecular Weight | 366.77 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 2-hydroxypropanoate;phenylmercury(1+) |
| SMILES | CC(O)C(=O)[O-].[Hg+]c1ccccc1 |
| InChI | InChI=1S/C6H5.C3H6O3.Hg/c1-2-4-6-5-3-1;1-2(4)3(5)6;/h1-5H;2,4H,1H3,(H,5,6);/q;;+1/p-1 |
| InChIKey | RRFGSWMKSSCUSU-UHFFFAOYSA-M |
| XLogP | -1.02 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.77 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropanoate;phenylmercury(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropanoate;phenylmercury(1+)?
The IUPAC name of 2-hydroxypropanoate;phenylmercury(1+) (CID 67544272) is 2-hydroxypropanoate;phenylmercury(1+).
What is the SMILES notation for 2-hydroxypropanoate;phenylmercury(1+)?
The canonical SMILES for 2-hydroxypropanoate;phenylmercury(1+) is CC(O)C(=O)[O-].[Hg+]c1ccccc1.
What is the InChIKey of 2-hydroxypropanoate;phenylmercury(1+)?
The InChIKey is RRFGSWMKSSCUSU-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5.C3H6O3.Hg/c1-2-4-6-5-3-1;1-2(4)3(5)6;/h1-5H;2,4H,1H3,(H,5,6);/q;;+1/p-1.
What are the key properties of 2-hydroxypropanoate;phenylmercury(1+)?
2-hydroxypropanoate;phenylmercury(1+) has a molecular weight of 366.77 g/mol, XLogP of -1.02, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropanoate;phenylmercury(1+) is sourced from PubChem (CID 67544272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).