About azane;phenylmercury(1+);acetate
azane;phenylmercury(1+);acetate (PubChem CID 90478884) has the molecular formula C8H11HgNO2
and a molecular weight of 353.77 g/mol. Its IUPAC name is azane;phenylmercury(1+);acetate.
Molecular Properties
| Compound Name | azane;phenylmercury(1+);acetate |
| PubChem CID | 90478884 |
| Molecular Formula | C8H11HgNO2 |
| Molecular Weight | 353.77 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | azane;phenylmercury(1+);acetate |
| SMILES | CC(=O)[O-].N.[Hg+]c1ccccc1 |
| InChI | InChI=1S/C6H5.C2H4O2.Hg.H3N/c1-2-4-6-5-3-1;1-2(3)4;;/h1-5H;1H3,(H,3,4);;1H3/q;;+1;/p-1 |
| InChIKey | LPDJEBDOSVRHKE-UHFFFAOYSA-M |
| XLogP | -0.22 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.77 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze azane;phenylmercury(1+);acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;phenylmercury(1+);acetate?
The IUPAC name of azane;phenylmercury(1+);acetate (CID 90478884) is azane;phenylmercury(1+);acetate.
What is the SMILES notation for azane;phenylmercury(1+);acetate?
The canonical SMILES for azane;phenylmercury(1+);acetate is CC(=O)[O-].N.[Hg+]c1ccccc1.
What is the InChIKey of azane;phenylmercury(1+);acetate?
The InChIKey is LPDJEBDOSVRHKE-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5.C2H4O2.Hg.H3N/c1-2-4-6-5-3-1;1-2(3)4;;/h1-5H;1H3,(H,3,4);;1H3/q;;+1;/p-1.
What are the key properties of azane;phenylmercury(1+);acetate?
azane;phenylmercury(1+);acetate has a molecular weight of 353.77 g/mol, XLogP of -0.22, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;phenylmercury(1+);acetate is sourced from PubChem (CID 90478884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).