About silver;benzene;acetate
silver;benzene;acetate (PubChem CID 174986985) has the molecular formula C8H9AgO2
and a molecular weight of 245.03 g/mol. Its IUPAC name is silver;benzene;acetate.
Molecular Properties
| Compound Name | silver;benzene;acetate |
| PubChem CID | 174986985 |
| Molecular Formula | C8H9AgO2 |
| Molecular Weight | 245.03 g/mol |
| Exact Mass | 243.97 |
| IUPAC Name | silver;benzene;acetate |
| SMILES | CC(=O)[O-].[Ag+].c1ccccc1 |
| InChI | InChI=1S/C6H6.C2H4O2.Ag/c1-2-4-6-5-3-1;1-2(3)4;/h1-6H;1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | XGKLIDYAEDCBAY-UHFFFAOYSA-M |
| XLogP | 0.44 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.03 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze silver;benzene;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver;benzene;acetate?
The IUPAC name of silver;benzene;acetate (CID 174986985) is silver;benzene;acetate.
What is the SMILES notation for silver;benzene;acetate?
The canonical SMILES for silver;benzene;acetate is CC(=O)[O-].[Ag+].c1ccccc1.
What is the InChIKey of silver;benzene;acetate?
The InChIKey is XGKLIDYAEDCBAY-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6.C2H4O2.Ag/c1-2-4-6-5-3-1;1-2(3)4;/h1-6H;1H3,(H,3,4);/q;;+1/p-1.
What are the key properties of silver;benzene;acetate?
silver;benzene;acetate has a molecular weight of 245.03 g/mol, XLogP of 0.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for silver;benzene;acetate is sourced from PubChem (CID 174986985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).