About calcium;hydrogen carbonate;acetate
calcium;hydrogen carbonate;acetate (PubChem CID 138401342) has the molecular formula C3H4CaO5
and a molecular weight of 160.14 g/mol. Its IUPAC name is calcium;hydrogen carbonate;acetate.
Molecular Properties
| Compound Name | calcium;hydrogen carbonate;acetate |
| PubChem CID | 138401342 |
| Molecular Formula | C3H4CaO5 |
| Molecular Weight | 160.14 g/mol |
| Exact Mass | 159.97 |
| IUPAC Name | calcium;hydrogen carbonate;acetate |
| SMILES | CC(=O)[O-].O=C([O-])O.[Ca+2] |
| InChI | InChI=1S/C2H4O2.CH2O3.Ca/c1-2(3)4;2-1(3)4;/h1H3,(H,3,4);(H2,2,3,4);/q;;+2/p-2 |
| InChIKey | UJGSZMARTYUAQQ-UHFFFAOYSA-L |
| XLogP | -2.74 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.14 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze calcium;hydrogen carbonate;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydrogen carbonate;acetate?
The IUPAC name of calcium;hydrogen carbonate;acetate (CID 138401342) is calcium;hydrogen carbonate;acetate.
What is the SMILES notation for calcium;hydrogen carbonate;acetate?
The canonical SMILES for calcium;hydrogen carbonate;acetate is CC(=O)[O-].O=C([O-])O.[Ca+2].
What is the InChIKey of calcium;hydrogen carbonate;acetate?
The InChIKey is UJGSZMARTYUAQQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H4O2.CH2O3.Ca/c1-2(3)4;2-1(3)4;/h1H3,(H,3,4);(H2,2,3,4);/q;;+2/p-2.
What are the key properties of calcium;hydrogen carbonate;acetate?
calcium;hydrogen carbonate;acetate has a molecular weight of 160.14 g/mol, XLogP of -2.74, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydrogen carbonate;acetate is sourced from PubChem (CID 138401342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).