About calcium;azane;acetate
calcium;azane;acetate (PubChem CID 19433381) has the molecular formula C2H6CaNO2+
and a molecular weight of 116.15 g/mol. Its IUPAC name is calcium;azane;acetate.
Molecular Properties
| Compound Name | calcium;azane;acetate |
| PubChem CID | 19433381 |
| Molecular Formula | C2H6CaNO2+ |
| Molecular Weight | 116.15 g/mol |
| Exact Mass | 116.00 |
| IUPAC Name | calcium;azane;acetate |
| SMILES | CC(=O)[O-].N.[Ca+2] |
| InChI | InChI=1S/C2H4O2.Ca.H3N/c1-2(3)4;;/h1H3,(H,3,4);;1H3/q;+2;/p-1 |
| InChIKey | AIRGDABFKMBKCZ-UHFFFAOYSA-M |
| XLogP | -1.46 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.15 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze calcium;azane;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;azane;acetate?
The IUPAC name of calcium;azane;acetate (CID 19433381) is calcium;azane;acetate.
What is the SMILES notation for calcium;azane;acetate?
The canonical SMILES for calcium;azane;acetate is CC(=O)[O-].N.[Ca+2].
What is the InChIKey of calcium;azane;acetate?
The InChIKey is AIRGDABFKMBKCZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.Ca.H3N/c1-2(3)4;;/h1H3,(H,3,4);;1H3/q;+2;/p-1.
What are the key properties of calcium;azane;acetate?
calcium;azane;acetate has a molecular weight of 116.15 g/mol, XLogP of -1.46, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;azane;acetate is sourced from PubChem (CID 19433381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).