C16H16O4Pd — CID 173036521
1,1'-biphenyl;palladium(2+);diacetate (PubChem CID 173036521) has the molecular formula C16H16O4Pd and a molecular weight of 378.72 g/mol. Its IUPAC name is 1,1'-biphenyl;palladium(2+);diacetate.
| Compound Name | 1,1'-biphenyl;palladium(2+);diacetate |
|---|---|
| PubChem CID | 173036521 |
| Molecular Formula | C16H16O4Pd |
| Molecular Weight | 378.72 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 1,1'-biphenyl;palladium(2+);diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Pd+2].c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.2C2H4O2.Pd/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2*1-2(3)4;/h1-10H;2*1H3,(H,3,4);/q;;;+2/p-2 |
| InChIKey | SEBJENAWPPPYSW-UHFFFAOYSA-L |
| XLogP | 0.86 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.72 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |