About bis(1,1'-biphenyl);carbonate
bis(1,1'-biphenyl);carbonate (PubChem CID 23514328) has the molecular formula C25H20O3-2
and a molecular weight of 368.43 g/mol. Its IUPAC name is bis(1,1'-biphenyl);carbonate.
Molecular Properties
| Compound Name | bis(1,1'-biphenyl);carbonate |
| PubChem CID | 23514328 |
| Molecular Formula | C25H20O3-2 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | bis(1,1'-biphenyl);carbonate |
| SMILES | O=C([O-])[O-].c1ccc(-c2ccccc2)cc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/2C12H10.CH2O3/c2*1-3-7-11(8-4-1)12-9-5-2-6-10-12;2-1(3)4/h2*1-10H;(H2,2,3,4)/p-2 |
| InChIKey | JAKQQNJMLCVDDC-UHFFFAOYSA-L |
| XLogP | 4.26 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(1,1'-biphenyl);carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1,1'-biphenyl);carbonate?
The IUPAC name of bis(1,1'-biphenyl);carbonate (CID 23514328) is bis(1,1'-biphenyl);carbonate.
What is the SMILES notation for bis(1,1'-biphenyl);carbonate?
The canonical SMILES for bis(1,1'-biphenyl);carbonate is O=C([O-])[O-].c1ccc(-c2ccccc2)cc1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of bis(1,1'-biphenyl);carbonate?
The InChIKey is JAKQQNJMLCVDDC-UHFFFAOYSA-L. The full InChI is InChI=1S/2C12H10.CH2O3/c2*1-3-7-11(8-4-1)12-9-5-2-6-10-12;2-1(3)4/h2*1-10H;(H2,2,3,4)/p-2.
What are the key properties of bis(1,1'-biphenyl);carbonate?
bis(1,1'-biphenyl);carbonate has a molecular weight of 368.43 g/mol, XLogP of 4.26, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1,1'-biphenyl);carbonate is sourced from PubChem (CID 23514328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).