C12H16NO4S- — CID 2241578
(2S)-3-methyl-2-[(3-methylphenyl)sulfonylamino]butanoate (PubChem CID 2241578) has the molecular formula C12H16NO4S- and a molecular weight of 270.33 g/mol. Its IUPAC name is (2S)-3-methyl-2-[(3-methylphenyl)sulfonylamino]butanoate.
| Compound Name | (2S)-3-methyl-2-[(3-methylphenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 2241578 |
| Molecular Formula | C12H16NO4S- |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | (2S)-3-methyl-2-[(3-methylphenyl)sulfonylamino]butanoate |
| SMILES | Cc1cccc(S(=O)(=O)N[C@H](C(=O)[O-])C(C)C)c1 |
| InChI | InChI=1S/C12H17NO4S/c1-8(2)11(12(14)15)13-18(16,17)10-6-4-5-9(3)7-10/h4-8,11,13H,1-3H3,(H,14,15)/p-1/t11-/m0/s1 |
| InChIKey | BWWCEFJLVLTEJB-NSHDSACASA-M |
| XLogP | 0.05 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |