C12H13NO6S-2 — CID 2422442
(2R)-2-[(3-methylphenyl)sulfonylamino]pentanedioate (PubChem CID 2422442) has the molecular formula C12H13NO6S-2 and a molecular weight of 299.30 g/mol. Its IUPAC name is (2R)-2-[(3-methylphenyl)sulfonylamino]pentanedioate.
| Compound Name | (2R)-2-[(3-methylphenyl)sulfonylamino]pentanedioate |
|---|---|
| PubChem CID | 2422442 |
| Molecular Formula | C12H13NO6S-2 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | (2R)-2-[(3-methylphenyl)sulfonylamino]pentanedioate |
| SMILES | Cc1cccc(S(=O)(=O)N[C@H](CCC(=O)[O-])C(=O)[O-])c1 |
| InChI | InChI=1S/C12H15NO6S/c1-8-3-2-4-9(7-8)20(18,19)13-10(12(16)17)5-6-11(14)15/h2-4,7,10,13H,5-6H2,1H3,(H,14,15)(H,16,17)/p-2/t10-/m1/s1 |
| InChIKey | IYXGETLESCCEKU-SNVBAGLBSA-L |
| XLogP | -2.08 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |