C11H10ClNO6S-2 — CID 2476101
(2R)-2-[(3-chlorophenyl)sulfonylamino]pentanedioate (PubChem CID 2476101) has the molecular formula C11H10ClNO6S-2 and a molecular weight of 319.72 g/mol. Its IUPAC name is (2R)-2-[(3-chlorophenyl)sulfonylamino]pentanedioate.
| Compound Name | (2R)-2-[(3-chlorophenyl)sulfonylamino]pentanedioate |
|---|---|
| PubChem CID | 2476101 |
| Molecular Formula | C11H10ClNO6S-2 |
| Molecular Weight | 319.72 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | (2R)-2-[(3-chlorophenyl)sulfonylamino]pentanedioate |
| SMILES | O=C([O-])CC[C@@H](NS(=O)(=O)c1cccc(Cl)c1)C(=O)[O-] |
| InChI | InChI=1S/C11H12ClNO6S/c12-7-2-1-3-8(6-7)20(18,19)13-9(11(16)17)4-5-10(14)15/h1-3,6,9,13H,4-5H2,(H,14,15)(H,16,17)/p-2/t9-/m1/s1 |
| InChIKey | HLWUFGHBMPJCRM-SECBINFHSA-L |
| XLogP | -1.73 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.72 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |