C10H12ClNO5S — CID 81076518
2-[(3-chlorophenyl)sulfonylamino]-3-methoxypropanoic acid (PubChem CID 81076518) has the molecular formula C10H12ClNO5S and a molecular weight of 293.73 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)sulfonylamino]-3-methoxypropanoic acid.
| Compound Name | 2-[(3-chlorophenyl)sulfonylamino]-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 81076518 |
| Molecular Formula | C10H12ClNO5S |
| Molecular Weight | 293.73 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 2-[(3-chlorophenyl)sulfonylamino]-3-methoxypropanoic acid |
| SMILES | COCC(NS(=O)(=O)c1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C10H12ClNO5S/c1-17-6-9(10(13)14)12-18(15,16)8-4-2-3-7(11)5-8/h2-5,9,12H,6H2,1H3,(H,13,14) |
| InChIKey | ABLDUJNSBWMYEL-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.73 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |