C10H12Cl2N2O5S — CID 166224314
2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-3-methoxypropanoic acid (PubChem CID 166224314) has the molecular formula C10H12Cl2N2O5S and a molecular weight of 343.19 g/mol. Its IUPAC name is 2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-3-methoxypropanoic acid.
| Compound Name | 2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 166224314 |
| Molecular Formula | C10H12Cl2N2O5S |
| Molecular Weight | 343.19 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | 2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-3-methoxypropanoic acid |
| SMILES | COCC(NS(=O)(=O)c1cc(Cl)c(N)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C10H12Cl2N2O5S/c1-19-4-8(10(15)16)14-20(17,18)5-2-6(11)9(13)7(12)3-5/h2-3,8,14H,4,13H2,1H3,(H,15,16) |
| InChIKey | SDONEZFWHCVNPW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|