C12H14Cl2N2O4 — CID 122135859
methyl 2-[(4-amino-3,5-dichlorobenzoyl)amino]-3-methoxypropanoate (PubChem CID 122135859) has the molecular formula C12H14Cl2N2O4 and a molecular weight of 321.16 g/mol. Its IUPAC name is methyl 2-[(4-amino-3,5-dichlorobenzoyl)amino]-3-methoxypropanoate.
| Compound Name | methyl 2-[(4-amino-3,5-dichlorobenzoyl)amino]-3-methoxypropanoate |
|---|---|
| PubChem CID | 122135859 |
| Molecular Formula | C12H14Cl2N2O4 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | methyl 2-[(4-amino-3,5-dichlorobenzoyl)amino]-3-methoxypropanoate |
| SMILES | COCC(NC(=O)c1cc(Cl)c(N)c(Cl)c1)C(=O)OC |
| InChI | InChI=1S/C12H14Cl2N2O4/c1-19-5-9(12(18)20-2)16-11(17)6-3-7(13)10(15)8(14)4-6/h3-4,9H,5,15H2,1-2H3,(H,16,17) |
| InChIKey | FKVYLNKEKJKXLR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|