C11H14ClN3O3 — CID 68641791
methyl (2S)-3-amino-2-[(4-amino-3-chlorobenzoyl)amino]propanoate (PubChem CID 68641791) has the molecular formula C11H14ClN3O3 and a molecular weight of 271.70 g/mol. Its IUPAC name is methyl (2S)-3-amino-2-[(4-amino-3-chlorobenzoyl)amino]propanoate.
| Compound Name | methyl (2S)-3-amino-2-[(4-amino-3-chlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 68641791 |
| Molecular Formula | C11H14ClN3O3 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | methyl (2S)-3-amino-2-[(4-amino-3-chlorobenzoyl)amino]propanoate |
| SMILES | COC(=O)[C@H](CN)NC(=O)c1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C11H14ClN3O3/c1-18-11(17)9(5-13)15-10(16)6-2-3-8(14)7(12)4-6/h2-4,9H,5,13-14H2,1H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | PFNABZQQDHPOAK-VIFPVBQESA-N |
| XLogP | 0.15 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|