C24H24ClN3O4 — CID 20714751
methyl 3-amino-2-[[2-chloro-4-(1-naphthalen-1-ylethylcarbamoyl)benzoyl]amino]propanoate (PubChem CID 20714751) has the molecular formula C24H24ClN3O4 and a molecular weight of 453.93 g/mol. Its IUPAC name is methyl 3-amino-2-[[2-chloro-4-(1-naphthalen-1-ylethylcarbamoyl)benzoyl]amino]propanoate.
| Compound Name | methyl 3-amino-2-[[2-chloro-4-(1-naphthalen-1-ylethylcarbamoyl)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 20714751 |
| Molecular Formula | C24H24ClN3O4 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | methyl 3-amino-2-[[2-chloro-4-(1-naphthalen-1-ylethylcarbamoyl)benzoyl]amino]propanoate |
| SMILES | COC(=O)C(CN)NC(=O)c1ccc(C(=O)NC(C)c2cccc3ccccc23)cc1Cl |
| InChI | InChI=1S/C24H24ClN3O4/c1-14(17-9-5-7-15-6-3-4-8-18(15)17)27-22(29)16-10-11-19(20(25)12-16)23(30)28-21(13-26)24(31)32-2/h3-12,14,21H,13,26H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | PPACYGOWAQYYEH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |