C19H20ClN3O5 — CID 20610073
methyl 3-amino-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]propanoate (PubChem CID 20610073) has the molecular formula C19H20ClN3O5 and a molecular weight of 405.84 g/mol. Its IUPAC name is methyl 3-amino-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]propanoate.
| Compound Name | methyl 3-amino-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 20610073 |
| Molecular Formula | C19H20ClN3O5 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | methyl 3-amino-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]propanoate |
| SMILES | COC(=O)C(CN)NC(=O)c1ccc(C(=O)NCc2cccc(O)c2)cc1Cl |
| InChI | InChI=1S/C19H20ClN3O5/c1-28-19(27)16(9-21)23-18(26)14-6-5-12(8-15(14)20)17(25)22-10-11-3-2-4-13(24)7-11/h2-8,16,24H,9-10,21H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | FAIRJFPELOMWJF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |