C23H19ClN4O9 — CID 68820867
(2S)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-3-[(5-nitrofuran-2-carbonyl)amino]propanoic acid (PubChem CID 68820867) has the molecular formula C23H19ClN4O9 and a molecular weight of 530.88 g/mol. Its IUPAC name is (2S)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-3-[(5-nitrofuran-2-carbonyl)amino]propanoic acid.
| Compound Name | (2S)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-3-[(5-nitrofuran-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 68820867 |
| Molecular Formula | C23H19ClN4O9 |
| Molecular Weight | 530.88 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | (2S)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-3-[(5-nitrofuran-2-carbonyl)amino]propanoic acid |
| SMILES | O=C(NCc1cccc(O)c1)c1ccc(C(=O)N[C@@H](CNC(=O)c2ccc([N+](=O)[O-])o2)C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C23H19ClN4O9/c24-16-9-13(20(30)25-10-12-2-1-3-14(29)8-12)4-5-15(16)21(31)27-17(23(33)34)11-26-22(32)18-6-7-19(37-18)28(35)36/h1-9,17,29H,10-11H2,(H,25,30)(H,26,32)(H,27,31)(H,33,34)/t17-/m0/s1 |
| InChIKey | UJNDBFKHKJITAA-KRWDZBQOSA-N |
| XLogP | 2.09 |
| TPSA | 201.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.88 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|