C25H20ClN5O10 — CID 86585141
(2S)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-3-[(3,5-dinitrobenzoyl)amino]propanoic acid (PubChem CID 86585141) has the molecular formula C25H20ClN5O10 and a molecular weight of 585.91 g/mol. Its IUPAC name is (2S)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-3-[(3,5-dinitrobenzoyl)amino]propanoic acid.
| Compound Name | (2S)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-3-[(3,5-dinitrobenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 86585141 |
| Molecular Formula | C25H20ClN5O10 |
| Molecular Weight | 585.91 g/mol |
| Exact Mass | 585.09 |
| IUPAC Name | (2S)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-3-[(3,5-dinitrobenzoyl)amino]propanoic acid |
| SMILES | O=C(NCc1cccc(O)c1)c1ccc(C(=O)N[C@@H](CNC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C25H20ClN5O10/c26-20-9-14(22(33)27-11-13-2-1-3-18(32)6-13)4-5-19(20)24(35)29-21(25(36)37)12-28-23(34)15-7-16(30(38)39)10-17(8-15)31(40)41/h1-10,21,32H,11-12H2,(H,27,33)(H,28,34)(H,29,35)(H,36,37)/t21-/m0/s1 |
| InChIKey | HFVQCRQBVQTUDL-NRFANRHFSA-N |
| XLogP | 2.40 |
| TPSA | 231.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.91 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|