C25H22ClN3O6S — CID 68821761
(2S)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-3-(3-thiophen-2-ylprop-2-enoylamino)propanoic acid (PubChem CID 68821761) has the molecular formula C25H22ClN3O6S and a molecular weight of 527.99 g/mol. Its IUPAC name is (2S)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-3-(3-thiophen-2-ylprop-2-enoylamino)propanoic acid.
| Compound Name | (2S)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-3-(3-thiophen-2-ylprop-2-enoylamino)propanoic acid |
|---|---|
| PubChem CID | 68821761 |
| Molecular Formula | C25H22ClN3O6S |
| Molecular Weight | 527.99 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | (2S)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-3-(3-thiophen-2-ylprop-2-enoylamino)propanoic acid |
| SMILES | O=C(C=Cc1cccs1)NC[C@H](NC(=O)c1ccc(C(=O)NCc2cccc(O)c2)cc1Cl)C(=O)O |
| InChI | InChI=1S/C25H22ClN3O6S/c26-20-12-16(23(32)28-13-15-3-1-4-17(30)11-15)6-8-19(20)24(33)29-21(25(34)35)14-27-22(31)9-7-18-5-2-10-36-18/h1-12,21,30H,13-14H2,(H,27,31)(H,28,32)(H,29,33)(H,34,35)/t21-/m0/s1 |
| InChIKey | UPCVYRIYCFIWOZ-NRFANRHFSA-N |
| XLogP | 3.05 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.99 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|