C19H15Cl2NO2 — CID 59038441
3,5-dichloro-4-hydroxy-N-[(1R)-1-naphthalen-1-ylethyl]benzamide (PubChem CID 59038441) has the molecular formula C19H15Cl2NO2 and a molecular weight of 360.24 g/mol. Its IUPAC name is 3,5-dichloro-4-hydroxy-N-[(1R)-1-naphthalen-1-ylethyl]benzamide.
| Compound Name | 3,5-dichloro-4-hydroxy-N-[(1R)-1-naphthalen-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 59038441 |
| Molecular Formula | C19H15Cl2NO2 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 3,5-dichloro-4-hydroxy-N-[(1R)-1-naphthalen-1-ylethyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1cc(Cl)c(O)c(Cl)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H15Cl2NO2/c1-11(14-8-4-6-12-5-2-3-7-15(12)14)22-19(24)13-9-16(20)18(23)17(21)10-13/h2-11,23H,1H3,(H,22,24)/t11-/m1/s1 |
| InChIKey | RZRCDDOBAXVWJS-LLVKDONJSA-N |
| XLogP | 5.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |