C21H23ClN2O — CID 170337610
2-(2-aminoethyl)-N-(1-naphthalen-1-ylethyl)benzamide;hydrochloride (PubChem CID 170337610) has the molecular formula C21H23ClN2O and a molecular weight of 354.88 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-(1-naphthalen-1-ylethyl)benzamide;hydrochloride.
| Compound Name | 2-(2-aminoethyl)-N-(1-naphthalen-1-ylethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 170337610 |
| Molecular Formula | C21H23ClN2O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-(2-aminoethyl)-N-(1-naphthalen-1-ylethyl)benzamide;hydrochloride |
| SMILES | CC(NC(=O)c1ccccc1CCN)c1cccc2ccccc12.Cl |
| InChI | InChI=1S/C21H22N2O.ClH/c1-15(18-12-6-9-16-7-2-4-10-19(16)18)23-21(24)20-11-5-3-8-17(20)13-14-22;/h2-12,15H,13-14,22H2,1H3,(H,23,24);1H |
| InChIKey | HQZIHIOBMUXUQE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |