C27H27N3O4 — CID 171822344
N'-[[2-[[(1R)-1-naphthalen-1-ylethyl]carbamoyl]phenyl]methyl]-N-[(E)-4-oxopent-2-enyl]oxamide (PubChem CID 171822344) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is N'-[[2-[[(1R)-1-naphthalen-1-ylethyl]carbamoyl]phenyl]methyl]-N-[(E)-4-oxopent-2-enyl]oxamide.
| Compound Name | N'-[[2-[[(1R)-1-naphthalen-1-ylethyl]carbamoyl]phenyl]methyl]-N-[(E)-4-oxopent-2-enyl]oxamide |
|---|---|
| PubChem CID | 171822344 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | N'-[[2-[[(1R)-1-naphthalen-1-ylethyl]carbamoyl]phenyl]methyl]-N-[(E)-4-oxopent-2-enyl]oxamide |
| SMILES | CC(=O)/C=C/CNC(=O)C(=O)NCc1ccccc1C(=O)N[C@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H27N3O4/c1-18(31)9-8-16-28-26(33)27(34)29-17-21-11-4-6-14-24(21)25(32)30-19(2)22-15-7-12-20-10-3-5-13-23(20)22/h3-15,19H,16-17H2,1-2H3,(H,28,33)(H,29,34)(H,30,32)/b9-8+/t19-/m1/s1 |
| InChIKey | UMLGEDNNUXKUFB-CSHXORCISA-N |
| XLogP | 3.21 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|