C29H32N4O4 — CID 174364412
N-[(E)-5-(dimethylamino)-5-oxopent-3-enyl]-N'-[[2-[[(1R)-1-naphthalen-1-ylethyl]carbamoyl]phenyl]methyl]oxamide (PubChem CID 174364412) has the molecular formula C29H32N4O4 and a molecular weight of 500.60 g/mol. Its IUPAC name is N-[(E)-5-(dimethylamino)-5-oxopent-3-enyl]-N'-[[2-[[(1R)-1-naphthalen-1-ylethyl]carbamoyl]phenyl]methyl]oxamide.
| Compound Name | N-[(E)-5-(dimethylamino)-5-oxopent-3-enyl]-N'-[[2-[[(1R)-1-naphthalen-1-ylethyl]carbamoyl]phenyl]methyl]oxamide |
|---|---|
| PubChem CID | 174364412 |
| Molecular Formula | C29H32N4O4 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | N-[(E)-5-(dimethylamino)-5-oxopent-3-enyl]-N'-[[2-[[(1R)-1-naphthalen-1-ylethyl]carbamoyl]phenyl]methyl]oxamide |
| SMILES | C[C@@H](NC(=O)c1ccccc1CNC(=O)C(=O)NCC/C=C/C(=O)N(C)C)c1cccc2ccccc12 |
| InChI | InChI=1S/C29H32N4O4/c1-20(23-16-10-13-21-11-4-6-14-24(21)23)32-27(35)25-15-7-5-12-22(25)19-31-29(37)28(36)30-18-9-8-17-26(34)33(2)3/h4-8,10-17,20H,9,18-19H2,1-3H3,(H,30,36)(H,31,37)(H,32,35)/b17-8+/t20-/m1/s1 |
| InChIKey | QPWQCYYKKJQTTQ-CFIBSBMNSA-N |
| XLogP | 3.10 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|