C26H24N4O3 — CID 171821949
N-[(E)-3-cyanoprop-2-enyl]-N'-[[2-(1-naphthalen-1-ylethylcarbamoyl)phenyl]methyl]oxamide (PubChem CID 171821949) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is N-[(E)-3-cyanoprop-2-enyl]-N'-[[2-(1-naphthalen-1-ylethylcarbamoyl)phenyl]methyl]oxamide.
| Compound Name | N-[(E)-3-cyanoprop-2-enyl]-N'-[[2-(1-naphthalen-1-ylethylcarbamoyl)phenyl]methyl]oxamide |
|---|---|
| PubChem CID | 171821949 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | N-[(E)-3-cyanoprop-2-enyl]-N'-[[2-(1-naphthalen-1-ylethylcarbamoyl)phenyl]methyl]oxamide |
| SMILES | CC(NC(=O)c1ccccc1CNC(=O)C(=O)NC/C=C/C#N)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H24N4O3/c1-18(21-14-8-11-19-9-2-4-12-22(19)21)30-24(31)23-13-5-3-10-20(23)17-29-26(33)25(32)28-16-7-6-15-27/h2-14,18H,16-17H2,1H3,(H,28,32)(H,29,33)(H,30,31)/b7-6+ |
| InChIKey | OOZDJZMJUZBRDM-VOTSOKGWSA-N |
| XLogP | 3.14 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|