C28H32N4O4 — CID 171822397
2-[[[2-hydroxy-2-[[(E)-4-(methylamino)-4-oxobut-2-enyl]amino]propanoyl]amino]methyl]-N-[(1R)-1-naphthalen-1-ylethyl]benzamide (PubChem CID 171822397) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is 2-[[[2-hydroxy-2-[[(E)-4-(methylamino)-4-oxobut-2-enyl]amino]propanoyl]amino]methyl]-N-[(1R)-1-naphthalen-1-ylethyl]benzamide.
| Compound Name | 2-[[[2-hydroxy-2-[[(E)-4-(methylamino)-4-oxobut-2-enyl]amino]propanoyl]amino]methyl]-N-[(1R)-1-naphthalen-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 171822397 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | 2-[[[2-hydroxy-2-[[(E)-4-(methylamino)-4-oxobut-2-enyl]amino]propanoyl]amino]methyl]-N-[(1R)-1-naphthalen-1-ylethyl]benzamide |
| SMILES | CNC(=O)/C=C/CNC(C)(O)C(=O)NCc1ccccc1C(=O)N[C@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H32N4O4/c1-19(22-15-8-12-20-10-4-6-13-23(20)22)32-26(34)24-14-7-5-11-21(24)18-30-27(35)28(2,36)31-17-9-16-25(33)29-3/h4-16,19,31,36H,17-18H2,1-3H3,(H,29,33)(H,30,35)(H,32,34)/b16-9+/t19-,28?/m1/s1 |
| InChIKey | MXRPUMJVQZKING-VFHPFYFOSA-N |
| XLogP | 2.55 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|