C11H15NO8S — CID 126803471
3-methoxy-2-[(4-methoxycarbonyl-5-methylfuran-2-yl)sulfonylamino]propanoic acid (PubChem CID 126803471) has the molecular formula C11H15NO8S and a molecular weight of 321.31 g/mol. Its IUPAC name is 3-methoxy-2-[(4-methoxycarbonyl-5-methylfuran-2-yl)sulfonylamino]propanoic acid.
| Compound Name | 3-methoxy-2-[(4-methoxycarbonyl-5-methylfuran-2-yl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 126803471 |
| Molecular Formula | C11H15NO8S |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 3-methoxy-2-[(4-methoxycarbonyl-5-methylfuran-2-yl)sulfonylamino]propanoic acid |
| SMILES | COCC(NS(=O)(=O)c1cc(C(=O)OC)c(C)o1)C(=O)O |
| InChI | InChI=1S/C11H15NO8S/c1-6-7(11(15)19-3)4-9(20-6)21(16,17)12-8(5-18-2)10(13)14/h4,8,12H,5H2,1-3H3,(H,13,14) |
| InChIKey | SAXRJTDUKLUXPU-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |