C8H8O5 — CID 55212082
4-methoxycarbonyl-5-methylfuran-2-carboxylic acid (PubChem CID 55212082) has the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. Its IUPAC name is 4-methoxycarbonyl-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-methoxycarbonyl-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 55212082 |
| Molecular Formula | C8H8O5 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 4-methoxycarbonyl-5-methylfuran-2-carboxylic acid |
| SMILES | COC(=O)c1cc(C(=O)O)oc1C |
| InChI | InChI=1S/C8H8O5/c1-4-5(8(11)12-2)3-6(13-4)7(9)10/h3H,1-2H3,(H,9,10) |
| InChIKey | HAVOWLIYILWFRJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |