C10H10O5 — CID 53405830
3-(4-methoxycarbonyl-5-methylfuran-2-yl)prop-2-enoic acid (PubChem CID 53405830) has the molecular formula C10H10O5 and a molecular weight of 210.19 g/mol. Its IUPAC name is 3-(4-methoxycarbonyl-5-methylfuran-2-yl)prop-2-enoic acid.
| Compound Name | 3-(4-methoxycarbonyl-5-methylfuran-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 53405830 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 3-(4-methoxycarbonyl-5-methylfuran-2-yl)prop-2-enoic acid |
| SMILES | COC(=O)c1cc(C=CC(=O)O)oc1C |
| InChI | InChI=1S/C10H10O5/c1-6-8(10(13)14-2)5-7(15-6)3-4-9(11)12/h3-5H,1-2H3,(H,11,12) |
| InChIKey | YSASBCPSKJYHQL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|