C19H19NO6 — CID 17414145
methyl 5-[(E)-3-(5-methoxycarbonyl-2-methylanilino)-3-oxoprop-1-enyl]-2-methylfuran-3-carboxylate (PubChem CID 17414145) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is methyl 5-[(E)-3-(5-methoxycarbonyl-2-methylanilino)-3-oxoprop-1-enyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[(E)-3-(5-methoxycarbonyl-2-methylanilino)-3-oxoprop-1-enyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 17414145 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | methyl 5-[(E)-3-(5-methoxycarbonyl-2-methylanilino)-3-oxoprop-1-enyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)/C=C/c2cc(C(=O)OC)c(C)o2)c1 |
| InChI | InChI=1S/C19H19NO6/c1-11-5-6-13(18(22)24-3)9-16(11)20-17(21)8-7-14-10-15(12(2)26-14)19(23)25-4/h5-10H,1-4H3,(H,20,21)/b8-7+ |
| InChIKey | ICWAHXGOVTYMNN-BQYQJAHWSA-N |
| XLogP | 3.12 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|