C17H15NO6 — CID 5342219
dimethyl 2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]benzene-1,4-dicarboxylate (PubChem CID 5342219) has the molecular formula C17H15NO6 and a molecular weight of 329.31 g/mol. Its IUPAC name is dimethyl 2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 5342219 |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | dimethyl 2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)/C=C/c2ccco2)c1 |
| InChI | InChI=1S/C17H15NO6/c1-22-16(20)11-5-7-13(17(21)23-2)14(10-11)18-15(19)8-6-12-4-3-9-24-12/h3-10H,1-2H3,(H,18,19)/b8-6+ |
| InChIKey | SPCXTVCXSYPEJA-SOFGYWHQSA-N |
| XLogP | 2.50 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|