C14H12O10 — CID 141444077
dimethyl furan-2,5-dicarboxylate;furan-2,5-dicarboxylic acid (PubChem CID 141444077) has the molecular formula C14H12O10 and a molecular weight of 340.24 g/mol. Its IUPAC name is dimethyl furan-2,5-dicarboxylate;furan-2,5-dicarboxylic acid.
| Compound Name | dimethyl furan-2,5-dicarboxylate;furan-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 141444077 |
| Molecular Formula | C14H12O10 |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | dimethyl furan-2,5-dicarboxylate;furan-2,5-dicarboxylic acid |
| SMILES | COC(=O)c1ccc(C(=O)OC)o1.O=C(O)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C8H8O5.C6H4O5/c1-11-7(9)5-3-4-6(13-5)8(10)12-2;7-5(8)3-1-2-4(11-3)6(9)10/h3-4H,1-2H3;1-2H,(H,7,8)(H,9,10) |
| InChIKey | YDUXGHVRZQBSQO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 153.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |