C24H22O15 — CID 145318532
5-[2-[5-[2-(5-carboxyfuran-2-carbonyl)oxyethoxycarbonyl]furan-2-carbonyl]oxyethoxycarbonyl]furan-2-carboxylic acid;ethane (PubChem CID 145318532) has the molecular formula C24H22O15 and a molecular weight of 550.43 g/mol. Its IUPAC name is 5-[2-[5-[2-(5-carboxyfuran-2-carbonyl)oxyethoxycarbonyl]furan-2-carbonyl]oxyethoxycarbonyl]furan-2-carboxylic acid;ethane.
| Compound Name | 5-[2-[5-[2-(5-carboxyfuran-2-carbonyl)oxyethoxycarbonyl]furan-2-carbonyl]oxyethoxycarbonyl]furan-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 145318532 |
| Molecular Formula | C24H22O15 |
| Molecular Weight | 550.43 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | 5-[2-[5-[2-(5-carboxyfuran-2-carbonyl)oxyethoxycarbonyl]furan-2-carbonyl]oxyethoxycarbonyl]furan-2-carboxylic acid;ethane |
| SMILES | CC.O=C(O)c1ccc(C(=O)OCCOC(=O)c2ccc(C(=O)OCCOC(=O)c3ccc(C(=O)O)o3)o2)o1 |
| InChI | InChI=1S/C22H16O15.C2H6/c23-17(24)11-1-3-13(35-11)19(27)31-7-9-33-21(29)15-5-6-16(37-15)22(30)34-10-8-32-20(28)14-4-2-12(36-14)18(25)26;1-2/h1-6H,7-10H2,(H,23,24)(H,25,26);1-2H3 |
| InChIKey | AADKCQJERXBIQJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 219.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|