C15H14O5 — CID 106946853
5-[3-(4-methoxyphenyl)propanoyl]furan-2-carboxylic acid (PubChem CID 106946853) has the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. Its IUPAC name is 5-[3-(4-methoxyphenyl)propanoyl]furan-2-carboxylic acid.
| Compound Name | 5-[3-(4-methoxyphenyl)propanoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 106946853 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 5-[3-(4-methoxyphenyl)propanoyl]furan-2-carboxylic acid |
| SMILES | COc1ccc(CCC(=O)c2ccc(C(=O)O)o2)cc1 |
| InChI | InChI=1S/C15H14O5/c1-19-11-5-2-10(3-6-11)4-7-12(16)13-8-9-14(20-13)15(17)18/h2-3,5-6,8-9H,4,7H2,1H3,(H,17,18) |
| InChIKey | VFTFUGTUBKBTLM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |