C11H15O5P — CID 70420158
[4-(4-methoxyphenyl)-2-oxobutyl]phosphonic acid (PubChem CID 70420158) has the molecular formula C11H15O5P and a molecular weight of 258.21 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)-2-oxobutyl]phosphonic acid.
| Compound Name | [4-(4-methoxyphenyl)-2-oxobutyl]phosphonic acid |
|---|---|
| PubChem CID | 70420158 |
| Molecular Formula | C11H15O5P |
| Molecular Weight | 258.21 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | [4-(4-methoxyphenyl)-2-oxobutyl]phosphonic acid |
| SMILES | COc1ccc(CCC(=O)CP(=O)(O)O)cc1 |
| InChI | InChI=1S/C11H15O5P/c1-16-11-6-3-9(4-7-11)2-5-10(12)8-17(13,14)15/h3-4,6-7H,2,5,8H2,1H3,(H2,13,14,15) |
| InChIKey | NWDLNQDGUKHLRH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|