C19H25N2O5P — CID 23435512
[6-[6-[(4-methoxyphenyl)methylamino]-2-pyridinyl]-2-oxohexyl]phosphonic acid (PubChem CID 23435512) has the molecular formula C19H25N2O5P and a molecular weight of 392.39 g/mol. Its IUPAC name is [6-[6-[(4-methoxyphenyl)methylamino]-2-pyridinyl]-2-oxohexyl]phosphonic acid.
| Compound Name | [6-[6-[(4-methoxyphenyl)methylamino]-2-pyridinyl]-2-oxohexyl]phosphonic acid |
|---|---|
| PubChem CID | 23435512 |
| Molecular Formula | C19H25N2O5P |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | [6-[6-[(4-methoxyphenyl)methylamino]-2-pyridinyl]-2-oxohexyl]phosphonic acid |
| SMILES | COc1ccc(CNc2cccc(CCCCC(=O)CP(=O)(O)O)n2)cc1 |
| InChI | InChI=1S/C19H25N2O5P/c1-26-18-11-9-15(10-12-18)13-20-19-8-4-6-16(21-19)5-2-3-7-17(22)14-27(23,24)25/h4,6,8-12H,2-3,5,7,13-14H2,1H3,(H,20,21)(H2,23,24,25) |
| InChIKey | JZQJBKZCTJGSLJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|