carbon dioxide;furan-2,5-dicarboxylic acid

C7H4O7 — CID 174931528

IUPACcarbon dioxide;furan-2,5-dicarboxylic acid
SMILESO=C(O)c1ccc(C(=O)O)o1.O=C=O
InChIInChI=1S/C6H4O5.CO2/c7-5(8)3-1-2-4(11-3)6(9)10;2-1-3/h1-2H,(H,7,8)(H,9,10);
InChIKeyBWGGLZKOFSQUEL-UHFFFAOYSA-N
MW200.10 g/mol
LogP0.09
Rot. Bonds2

About carbon dioxide;furan-2,5-dicarboxylic acid

carbon dioxide;furan-2,5-dicarboxylic acid (PubChem CID 174931528) has the molecular formula C7H4O7 and a molecular weight of 200.10 g/mol. Its IUPAC name is carbon dioxide;furan-2,5-dicarboxylic acid.

Molecular Properties

Compound Namecarbon dioxide;furan-2,5-dicarboxylic acid
PubChem CID174931528
Molecular FormulaC7H4O7
Molecular Weight200.10 g/mol
Exact Mass200.00
IUPAC Namecarbon dioxide;furan-2,5-dicarboxylic acid
SMILESO=C(O)c1ccc(C(=O)O)o1.O=C=O
InChIInChI=1S/C6H4O5.CO2/c7-5(8)3-1-2-4(11-3)6(9)10;2-1-3/h1-2H,(H,7,8)(H,9,10);
InChIKeyBWGGLZKOFSQUEL-UHFFFAOYSA-N
XLogP0.09
TPSA121.88 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.10
LogP ≤ 50.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze carbon dioxide;furan-2,5-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

furan-2,5-dicarboxylic acid;indigane
CID 174700126
benzene-1,4-diamine;furan-2,5-dicarboxylic acid
CID 160946255
5-carboxyfuran-2-olate
CID 145013315
5-(2,2-dimethylpropanoyl)furan-2-carboxylic acid
CID 84720708
furan-2-carboxylic acid;furan-2,5-dicarboxylic acid
CID 158946082
5-methoxycarbonylfuran-2-carboxylic acid
CID 11435181
benzene-1,3-diamine;furan-2,5-dicarboxylic acid
CID 175422690
dimethyl furan-2,5-dicarboxylate;furan-2,5-dicarboxylic acid
CID 141444077
5-(5-chlorofuran-2-carbonyl)furan-2-carboxylic acid
CID 106946887
bis(5-carboxyfuran-2-yl)iodanium
CID 139729150
5-trimethylgermylfuran-2-carboxylic acid
CID 13199575
5-[2-[5-[2-(5-carboxyfuran-2-carbonyl)oxyethoxycarbonyl]furan-2-carbonyl]oxyethoxycarbonyl]furan-2-carboxylic acid;ethane
CID 145318532

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;furan-2,5-dicarboxylic acid?
The IUPAC name of carbon dioxide;furan-2,5-dicarboxylic acid (CID 174931528) is carbon dioxide;furan-2,5-dicarboxylic acid.
What is the SMILES notation for carbon dioxide;furan-2,5-dicarboxylic acid?
The canonical SMILES for carbon dioxide;furan-2,5-dicarboxylic acid is O=C(O)c1ccc(C(=O)O)o1.O=C=O.
What is the InChIKey of carbon dioxide;furan-2,5-dicarboxylic acid?
The InChIKey is BWGGLZKOFSQUEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O5.CO2/c7-5(8)3-1-2-4(11-3)6(9)10;2-1-3/h1-2H,(H,7,8)(H,9,10);.
What are the key properties of carbon dioxide;furan-2,5-dicarboxylic acid?
carbon dioxide;furan-2,5-dicarboxylic acid has a molecular weight of 200.10 g/mol, XLogP of 0.09, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;furan-2,5-dicarboxylic acid is sourced from PubChem (CID 174931528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).