C12H12N2O5 — CID 175422690
benzene-1,3-diamine;furan-2,5-dicarboxylic acid (PubChem CID 175422690) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is benzene-1,3-diamine;furan-2,5-dicarboxylic acid.
| Compound Name | benzene-1,3-diamine;furan-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 175422690 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | benzene-1,3-diamine;furan-2,5-dicarboxylic acid |
| SMILES | Nc1cccc(N)c1.O=C(O)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C6H8N2.C6H4O5/c7-5-2-1-3-6(8)4-5;7-5(8)3-1-2-4(11-3)6(9)10/h1-4H,7-8H2;1-2H,(H,7,8)(H,9,10) |
| InChIKey | MWKFKDQPWMHISV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 139.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|