C11H8O8 — CID 158946082
furan-2-carboxylic acid;furan-2,5-dicarboxylic acid (PubChem CID 158946082) has the molecular formula C11H8O8 and a molecular weight of 268.18 g/mol. Its IUPAC name is furan-2-carboxylic acid;furan-2,5-dicarboxylic acid.
| Compound Name | furan-2-carboxylic acid;furan-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 158946082 |
| Molecular Formula | C11H8O8 |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | furan-2-carboxylic acid;furan-2,5-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)o1.O=C(O)c1ccco1 |
| InChI | InChI=1S/C6H4O5.C5H4O3/c7-5(8)3-1-2-4(11-3)6(9)10;6-5(7)4-2-1-3-8-4/h1-2H,(H,7,8)(H,9,10);1-3H,(H,6,7) |
| InChIKey | JKVLJGARQOKPCN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 138.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |