About furan-2-carboxylic acid;methanol
furan-2-carboxylic acid;methanol (PubChem CID 70611195) has the molecular formula C6H8O4
and a molecular weight of 144.13 g/mol. Its IUPAC name is furan-2-carboxylic acid;methanol.
Molecular Properties
| Compound Name | furan-2-carboxylic acid;methanol |
| PubChem CID | 70611195 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | furan-2-carboxylic acid;methanol |
| SMILES | CO.O=C(O)c1ccco1 |
| InChI | InChI=1S/C5H4O3.CH4O/c6-5(7)4-2-1-3-8-4;1-2/h1-3H,(H,6,7);2H,1H3 |
| InChIKey | AFLKEMGXVMTFMY-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze furan-2-carboxylic acid;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-carboxylic acid;methanol?
The IUPAC name of furan-2-carboxylic acid;methanol (CID 70611195) is furan-2-carboxylic acid;methanol.
What is the SMILES notation for furan-2-carboxylic acid;methanol?
The canonical SMILES for furan-2-carboxylic acid;methanol is CO.O=C(O)c1ccco1.
What is the InChIKey of furan-2-carboxylic acid;methanol?
The InChIKey is AFLKEMGXVMTFMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4O3.CH4O/c6-5(7)4-2-1-3-8-4;1-2/h1-3H,(H,6,7);2H,1H3.
What are the key properties of furan-2-carboxylic acid;methanol?
furan-2-carboxylic acid;methanol has a molecular weight of 144.13 g/mol, XLogP of 0.59, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-carboxylic acid;methanol is sourced from PubChem (CID 70611195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).