About zinc furan-2-carboxylic acid
zinc furan-2-carboxylic acid (PubChem CID 25022579) has the molecular formula C5H4O3Zn+2
and a molecular weight of 177.47 g/mol. Its IUPAC name is zinc furan-2-carboxylic acid.
Molecular Properties
| Compound Name | zinc furan-2-carboxylic acid |
| PubChem CID | 25022579 |
| Molecular Formula | C5H4O3Zn+2 |
| Molecular Weight | 177.47 g/mol |
| Exact Mass | 175.94 |
| IUPAC Name | zinc furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccco1.[Zn+2] |
| InChI | InChI=1S/C5H4O3.Zn/c6-5(7)4-2-1-3-8-4;/h1-3H,(H,6,7);/q;+2 |
| InChIKey | MHAGZNYZSQMDFY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.47 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc furan-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc furan-2-carboxylic acid?
The IUPAC name of zinc furan-2-carboxylic acid (CID 25022579) is zinc furan-2-carboxylic acid.
What is the SMILES notation for zinc furan-2-carboxylic acid?
The canonical SMILES for zinc furan-2-carboxylic acid is O=C(O)c1ccco1.[Zn+2].
What is the InChIKey of zinc furan-2-carboxylic acid?
The InChIKey is MHAGZNYZSQMDFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4O3.Zn/c6-5(7)4-2-1-3-8-4;/h1-3H,(H,6,7);/q;+2.
What are the key properties of zinc furan-2-carboxylic acid?
zinc furan-2-carboxylic acid has a molecular weight of 177.47 g/mol, XLogP of 0.98, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc furan-2-carboxylic acid is sourced from PubChem (CID 25022579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).