C17H10Cl3F3O4 — CID 125498132
methyl 2-methyl-5-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-2-enoyl]furan-3-carboxylate (PubChem CID 125498132) has the molecular formula C17H10Cl3F3O4 and a molecular weight of 441.62 g/mol. Its IUPAC name is methyl 2-methyl-5-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-2-enoyl]furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-2-enoyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 125498132 |
| Molecular Formula | C17H10Cl3F3O4 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 439.96 |
| IUPAC Name | methyl 2-methyl-5-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-2-enoyl]furan-3-carboxylate |
| SMILES | COC(=O)c1cc(C(=O)/C=C(\c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)oc1C |
| InChI | InChI=1S/C17H10Cl3F3O4/c1-7-9(16(25)26-2)5-14(27-7)13(24)6-10(17(21,22)23)8-3-11(18)15(20)12(19)4-8/h3-6H,1-2H3/b10-6+ |
| InChIKey | JTMCHCGMAMXDDV-UXBLZVDNSA-N |
| XLogP | 6.16 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|